C24H17N5O4S — CID 118472489
2-[[5-[3-nitro-5-(2-phenyl-1H-indol-5-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 118472489) has the molecular formula C24H17N5O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is 2-[[5-[3-nitro-5-(2-phenyl-1H-indol-5-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-nitro-5-(2-phenyl-1H-indol-5-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 118472489 |
| Molecular Formula | C24H17N5O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-[[5-[3-nitro-5-(2-phenyl-1H-indol-5-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1n[nH]c(-c2cc(-c3ccc4[nH]c(-c5ccccc5)cc4c3)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C24H17N5O4S/c30-22(31)13-34-24-26-23(27-28-24)18-9-16(10-19(11-18)29(32)33)15-6-7-20-17(8-15)12-21(25-20)14-4-2-1-3-5-14/h1-12,25H,13H2,(H,30,31)(H,26,27,28) |
| InChIKey | JLQKBIXBINMOHF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|