C28H34N4O3 — CID 118473233
N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 118473233) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118473233 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | N-[(1S)-1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N[C@@H](C)c2ccc(O[C@@H]3CCN(c4ccc(OCC5CC5)cc4)C3)cc2)cnn1C |
| InChI | InChI=1S/C28H34N4O3/c1-19(30-28(33)27-16-29-31(3)20(27)2)22-6-10-25(11-7-22)35-26-14-15-32(17-26)23-8-12-24(13-9-23)34-18-21-4-5-21/h6-13,16,19,21,26H,4-5,14-15,17-18H2,1-3H3,(H,30,33)/t19-,26+/m0/s1 |
| InChIKey | GRQUGFWMMZDOES-AFMDSPMNSA-N |
| XLogP | 4.67 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|