C19H31N5O5 — CID 118473739
(4S)-3-[[3-[ethanimidoyl(ethylaminooxy)amino]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 118473739) has the molecular formula C19H31N5O5 and a molecular weight of 409.49 g/mol. Its IUPAC name is (4S)-3-[[3-[ethanimidoyl(ethylaminooxy)amino]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S)-3-[[3-[ethanimidoyl(ethylaminooxy)amino]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 118473739 |
| Molecular Formula | C19H31N5O5 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (4S)-3-[[3-[ethanimidoyl(ethylaminooxy)amino]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | [H]/N=C(\C)N(ONCC)C1CCN(CC2=C(C(=O)O)N3C(=O)C([C@@H](C)O)C3[C@H]2C)C1 |
| InChI | InChI=1S/C19H31N5O5/c1-5-21-29-24(12(4)20)13-6-7-22(8-13)9-14-10(2)16-15(11(3)25)18(26)23(16)17(14)19(27)28/h10-11,13,15-16,20-21,25H,5-9H2,1-4H3,(H,27,28)/b20-12+/t10-,11+,13?,15?,16?/m0/s1 |
| InChIKey | CQXSMQJTOMBBSJ-FJSZYIMHSA-N |
| XLogP | 0.01 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|