C8H14N2O2 — CID 118473852
(1-hydroxycyclopropyl)-[3-(methylamino)azetidin-1-yl]methanone (PubChem CID 118473852) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (1-hydroxycyclopropyl)-[3-(methylamino)azetidin-1-yl]methanone.
| Compound Name | (1-hydroxycyclopropyl)-[3-(methylamino)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 118473852 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (1-hydroxycyclopropyl)-[3-(methylamino)azetidin-1-yl]methanone |
| SMILES | CNC1CN(C(=O)C2(O)CC2)C1 |
| InChI | InChI=1S/C8H14N2O2/c1-9-6-4-10(5-6)7(11)8(12)2-3-8/h6,9,12H,2-5H2,1H3 |
| InChIKey | RDOXNHOBMFZVRA-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |