C37H40N4O4 — CID 118474231
ethyl (3Z)-3-[[cyclopropyl-[1-[2-(1-methylpiperidin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate (PubChem CID 118474231) has the molecular formula C37H40N4O4 and a molecular weight of 604.75 g/mol. Its IUPAC name is ethyl (3Z)-3-[[cyclopropyl-[1-[2-(1-methylpiperidin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate.
| Compound Name | ethyl (3Z)-3-[[cyclopropyl-[1-[2-(1-methylpiperidin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 118474231 |
| Molecular Formula | C37H40N4O4 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | ethyl (3Z)-3-[[cyclopropyl-[1-[2-(1-methylpiperidin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)NC(=O)/C2=C(/c1ccccc1)N(c1ccc2c(c1)CCN2C(=O)CC1CCN(C)CC1)C1CC1 |
| InChI | InChI=1S/C37H40N4O4/c1-3-45-37(44)27-9-13-30-31(23-27)38-36(43)34(30)35(25-7-5-4-6-8-25)41(28-10-11-28)29-12-14-32-26(22-29)17-20-40(32)33(42)21-24-15-18-39(2)19-16-24/h4-9,12-14,22-24,28H,3,10-11,15-21H2,1-2H3,(H,38,43)/b35-34- |
| InChIKey | SLYYKCSEHJNEMG-KNWKATPGSA-N |
| XLogP | 5.97 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|