C35H36N4O4 — CID 118474243
methyl (3Z)-3-[[cyclopropyl-[1-(2-piperidin-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate (PubChem CID 118474243) has the molecular formula C35H36N4O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is methyl (3Z)-3-[[cyclopropyl-[1-(2-piperidin-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate.
| Compound Name | methyl (3Z)-3-[[cyclopropyl-[1-(2-piperidin-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 118474243 |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | methyl (3Z)-3-[[cyclopropyl-[1-(2-piperidin-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)/C2=C(/c1ccccc1)N(c1ccc2c(c1)CCN2C(=O)CN1CCCCC1)C1CC1 |
| InChI | InChI=1S/C35H36N4O4/c1-43-35(42)25-10-14-28-29(21-25)36-34(41)32(28)33(23-8-4-2-5-9-23)39(26-11-12-26)27-13-15-30-24(20-27)16-19-38(30)31(40)22-37-17-6-3-7-18-37/h2,4-5,8-10,13-15,20-21,26H,3,6-7,11-12,16-19,22H2,1H3,(H,36,41)/b33-32- |
| InChIKey | APXKTQQZYKYLEX-KARKAFJISA-N |
| XLogP | 5.34 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|