C34H55N5O12 — CID 118474329
oxiran-2-ylmethyl N-[6-[1,3-bis[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl]carbamate (PubChem CID 118474329) has the molecular formula C34H55N5O12 and a molecular weight of 725.84 g/mol. Its IUPAC name is oxiran-2-ylmethyl N-[6-[1,3-bis[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl]carbamate.
| Compound Name | oxiran-2-ylmethyl N-[6-[1,3-bis[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 118474329 |
| Molecular Formula | C34H55N5O12 |
| Molecular Weight | 725.84 g/mol |
| Exact Mass | 725.38 |
| IUPAC Name | oxiran-2-ylmethyl N-[6-[1,3-bis[6-(oxiran-2-ylmethoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl]carbamate |
| SMILES | O=C(NCCCCCCC1C(=O)N(CCCCCCNC(=O)OCC2CO2)C(=O)N(CCCCCCNC(=O)OCC2CO2)C1=O)OCC1CO1 |
| InChI | InChI=1S/C34H55N5O12/c40-29-28(13-7-1-2-8-14-35-31(42)49-22-25-19-46-25)30(41)39(18-12-6-4-10-16-37-33(44)51-24-27-21-48-27)34(45)38(29)17-11-5-3-9-15-36-32(43)50-23-26-20-47-26/h25-28H,1-24H2,(H,35,42)(H,36,43)(H,37,44) |
| InChIKey | IREONUMESLGWJC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 210.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|