C16H20F6O2S — CID 118474591
2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-1,3-di(propan-2-yl)benzene (PubChem CID 118474591) has the molecular formula C16H20F6O2S and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 118474591 |
| Molecular Formula | C16H20F6O2S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1S(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C16H20F6O2S/c1-9(2)11-7-6-8-12(10(3)4)13(11)25(23,24)16(21,22)15(19,20)14(5,17)18/h6-10H,1-5H3 |
| InChIKey | RJSFFPHYXBUMNU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|