About (5R)-4,5-dichloro-1-methylcyclohexene
(5R)-4,5-dichloro-1-methylcyclohexene (PubChem CID 118474866) has the molecular formula C7H10Cl2
and a molecular weight of 165.06 g/mol. Its IUPAC name is (5R)-4,5-dichloro-1-methylcyclohexene.
Molecular Properties
| Compound Name | (5R)-4,5-dichloro-1-methylcyclohexene |
| PubChem CID | 118474866 |
| Molecular Formula | C7H10Cl2 |
| Molecular Weight | 165.06 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | (5R)-4,5-dichloro-1-methylcyclohexene |
| SMILES | CC1=CCC(Cl)[C@H](Cl)C1 |
| InChI | InChI=1S/C7H10Cl2/c1-5-2-3-6(8)7(9)4-5/h2,6-7H,3-4H2,1H3/t6?,7-/m1/s1 |
| InChIKey | YGGHHZYDSZSVFO-COBSHVIPSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.06 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-4,5-dichloro-1-methylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4,5-dichloro-1-methylcyclohexene?
The IUPAC name of (5R)-4,5-dichloro-1-methylcyclohexene (CID 118474866) is (5R)-4,5-dichloro-1-methylcyclohexene.
What is the SMILES notation for (5R)-4,5-dichloro-1-methylcyclohexene?
The canonical SMILES for (5R)-4,5-dichloro-1-methylcyclohexene is CC1=CCC(Cl)[C@H](Cl)C1.
What is the InChIKey of (5R)-4,5-dichloro-1-methylcyclohexene?
The InChIKey is YGGHHZYDSZSVFO-COBSHVIPSA-N. The full InChI is InChI=1S/C7H10Cl2/c1-5-2-3-6(8)7(9)4-5/h2,6-7H,3-4H2,1H3/t6?,7-/m1/s1.
What are the key properties of (5R)-4,5-dichloro-1-methylcyclohexene?
(5R)-4,5-dichloro-1-methylcyclohexene has a molecular weight of 165.06 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4,5-dichloro-1-methylcyclohexene is sourced from PubChem (CID 118474866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).