About 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene
7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene (PubChem CID 118474892) has the molecular formula C9H9ClS
and a molecular weight of 184.69 g/mol. Its IUPAC name is 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene.
Molecular Properties
| Compound Name | 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene |
| PubChem CID | 118474892 |
| Molecular Formula | C9H9ClS |
| Molecular Weight | 184.69 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene |
| SMILES | CC1=CC2C=CSC2C(Cl)=C1 |
| InChI | InChI=1S/C9H9ClS/c1-6-4-7-2-3-11-9(7)8(10)5-6/h2-5,7,9H,1H3 |
| InChIKey | PCMVGGHYEZMBFX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene?
The IUPAC name of 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene (CID 118474892) is 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene.
What is the SMILES notation for 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene?
The canonical SMILES for 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene is CC1=CC2C=CSC2C(Cl)=C1.
What is the InChIKey of 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene?
The InChIKey is PCMVGGHYEZMBFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClS/c1-6-4-7-2-3-11-9(7)8(10)5-6/h2-5,7,9H,1H3.
What are the key properties of 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene?
7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene has a molecular weight of 184.69 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-methyl-3a,7a-dihydro-1-benzothiophene is sourced from PubChem (CID 118474892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).