C26H29FN6O2 — CID 118474944
methyl 11-[(3-fluorophenyl)methyl]-13-(3-piperidin-1-ylpropylamino)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118474944) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is methyl 11-[(3-fluorophenyl)methyl]-13-(3-piperidin-1-ylpropylamino)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 11-[(3-fluorophenyl)methyl]-13-(3-piperidin-1-ylpropylamino)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118474944 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | methyl 11-[(3-fluorophenyl)methyl]-13-(3-piperidin-1-ylpropylamino)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3cccc(F)c3)nc(NCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C26H29FN6O2/c1-35-26(34)18-15-20-23(29-16-18)22-24(28-9-6-12-33-10-3-2-4-11-33)31-21(32-25(22)30-20)14-17-7-5-8-19(27)13-17/h5,7-8,13,15-16H,2-4,6,9-12,14H2,1H3,(H2,28,30,31,32) |
| InChIKey | NRDCCFDSFWZEBZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|