C24H27N5O2S2 — CID 118474971
methyl 13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118474971) has the molecular formula C24H27N5O2S2 and a molecular weight of 481.65 g/mol. Its IUPAC name is methyl 13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118474971 |
| Molecular Formula | C24H27N5O2S2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | methyl 13-(3-piperidin-1-ylpropylsulfanyl)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3ccsc3)nc(SCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C24H27N5O2S2/c1-31-24(30)17-13-18-21(25-14-17)20-22(26-18)27-19(12-16-6-11-32-15-16)28-23(20)33-10-5-9-29-7-3-2-4-8-29/h6,11,13-15H,2-5,7-10,12H2,1H3,(H,26,27,28) |
| InChIKey | QDGIIBQAWWKMEH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|