C24H28N6O2S — CID 118474987
methyl 13-(3-piperidin-1-ylpropylamino)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118474987) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is methyl 13-(3-piperidin-1-ylpropylamino)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 13-(3-piperidin-1-ylpropylamino)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118474987 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | methyl 13-(3-piperidin-1-ylpropylamino)-11-(thiophen-3-ylmethyl)-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3ccsc3)nc(NCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C24H28N6O2S/c1-32-24(31)17-13-18-21(26-14-17)20-22(25-7-5-10-30-8-3-2-4-9-30)28-19(29-23(20)27-18)12-16-6-11-33-15-16/h6,11,13-15H,2-5,7-10,12H2,1H3,(H2,25,27,28,29) |
| InChIKey | PNBOMXGMQPWHAF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|