C22H23FN6O2 — CID 118475001
methyl 11-[(3-fluorophenyl)methyl]-13-[3-(methylamino)propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118475001) has the molecular formula C22H23FN6O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is methyl 11-[(3-fluorophenyl)methyl]-13-[3-(methylamino)propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 11-[(3-fluorophenyl)methyl]-13-[3-(methylamino)propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118475001 |
| Molecular Formula | C22H23FN6O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | methyl 11-[(3-fluorophenyl)methyl]-13-[3-(methylamino)propylamino]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | CNCCCNc1nc(Cc2cccc(F)c2)nc2[nH]c3cc(C(=O)OC)cnc3c12 |
| InChI | InChI=1S/C22H23FN6O2/c1-24-7-4-8-25-20-18-19-16(11-14(12-26-19)22(30)31-2)27-21(18)29-17(28-20)10-13-5-3-6-15(23)9-13/h3,5-6,9,11-12,24H,4,7-8,10H2,1-2H3,(H2,25,27,28,29) |
| InChIKey | YGFPWOFQBZSRJW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|