C25H30FN7O2 — CID 118475007
methyl 13-[3-[3-aminopropyl(methyl)amino]propylamino]-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 118475007) has the molecular formula C25H30FN7O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is methyl 13-[3-[3-aminopropyl(methyl)amino]propylamino]-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 13-[3-[3-aminopropyl(methyl)amino]propylamino]-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 118475007 |
| Molecular Formula | C25H30FN7O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | methyl 13-[3-[3-aminopropyl(methyl)amino]propylamino]-11-[(3-fluorophenyl)methyl]-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)[nH]c1nc(Cc3cccc(F)c3)nc(NCCCN(C)CCCN)c12 |
| InChI | InChI=1S/C25H30FN7O2/c1-33(10-4-8-27)11-5-9-28-23-21-22-19(14-17(15-29-22)25(34)35-2)30-24(21)32-20(31-23)13-16-6-3-7-18(26)12-16/h3,6-7,12,14-15H,4-5,8-11,13,27H2,1-2H3,(H2,28,30,31,32) |
| InChIKey | RIILVKIETCJUDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|