About 1,1-difluoro-N-methylhepta-4,5-dien-2-imine
1,1-difluoro-N-methylhepta-4,5-dien-2-imine (PubChem CID 118475059) has the molecular formula C8H11F2N
and a molecular weight of 159.18 g/mol. Its IUPAC name is 1,1-difluoro-N-methylhepta-4,5-dien-2-imine.
Molecular Properties
| Compound Name | 1,1-difluoro-N-methylhepta-4,5-dien-2-imine |
| PubChem CID | 118475059 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1,1-difluoro-N-methylhepta-4,5-dien-2-imine |
| SMILES | CC=C=CC/C(=N\C)C(F)F |
| InChI | InChI=1S/C8H11F2N/c1-3-4-5-6-7(11-2)8(9)10/h3,5,8H,6H2,1-2H3/b11-7+ |
| InChIKey | VSWJDZAIDUSTCL-YRNVUSSQSA-N |
| XLogP | 2.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-N-methylhepta-4,5-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-N-methylhepta-4,5-dien-2-imine?
The IUPAC name of 1,1-difluoro-N-methylhepta-4,5-dien-2-imine (CID 118475059) is 1,1-difluoro-N-methylhepta-4,5-dien-2-imine.
What is the SMILES notation for 1,1-difluoro-N-methylhepta-4,5-dien-2-imine?
The canonical SMILES for 1,1-difluoro-N-methylhepta-4,5-dien-2-imine is CC=C=CC/C(=N\C)C(F)F.
What is the InChIKey of 1,1-difluoro-N-methylhepta-4,5-dien-2-imine?
The InChIKey is VSWJDZAIDUSTCL-YRNVUSSQSA-N. The full InChI is InChI=1S/C8H11F2N/c1-3-4-5-6-7(11-2)8(9)10/h3,5,8H,6H2,1-2H3/b11-7+.
What are the key properties of 1,1-difluoro-N-methylhepta-4,5-dien-2-imine?
1,1-difluoro-N-methylhepta-4,5-dien-2-imine has a molecular weight of 159.18 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-N-methylhepta-4,5-dien-2-imine is sourced from PubChem (CID 118475059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).