About N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide
N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide (PubChem CID 11847518) has the molecular formula C17H27N3O2
and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide |
| PubChem CID | 11847518 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide |
| SMILES | Cc1cc(N2CCOCC2)nc(C)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C17H27N3O2/c1-12-10-14(20-6-8-22-9-7-20)18-13(2)16(12)19-15(21)11-17(3,4)5/h10H,6-9,11H2,1-5H3,(H,19,21) |
| InChIKey | BKFDFCVASNKPOA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide?
The IUPAC name of N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide (CID 11847518) is N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide.
What is the SMILES notation for N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide?
The canonical SMILES for N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide is Cc1cc(N2CCOCC2)nc(C)c1NC(=O)CC(C)(C)C.
What is the InChIKey of N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide?
The InChIKey is BKFDFCVASNKPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O2/c1-12-10-14(20-6-8-22-9-7-20)18-13(2)16(12)19-15(21)11-17(3,4)5/h10H,6-9,11H2,1-5H3,(H,19,21).
What are the key properties of N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide?
N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide has a molecular weight of 305.42 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethyl-6-morpholin-4-yl-3-pyridinyl)-3,3-dimethylbutanamide is sourced from PubChem (CID 11847518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).