C9H16O6S — CID 11847537
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-ylsulfanyloxane-2-carboxylic acid (PubChem CID 11847537) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-ylsulfanyloxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-ylsulfanyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11847537 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-propan-2-ylsulfanyloxane-2-carboxylic acid |
| SMILES | CC(C)S[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O6S/c1-3(2)16-9-6(12)4(10)5(11)7(15-9)8(13)14/h3-7,9-12H,1-2H3,(H,13,14)/t4-,5-,6+,7-,9-/m0/s1 |
| InChIKey | OJOYPVVEPQFPPZ-MNDKRXPHSA-N |
| XLogP | -0.98 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |