C26H26ClF2N7O2 — CID 118475632
N-[3-[[[2-[4-(4-acetylpiperazin-1-yl)-3,5-difluoroanilino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 118475632) has the molecular formula C26H26ClF2N7O2 and a molecular weight of 541.99 g/mol. Its IUPAC name is N-[3-[[[2-[4-(4-acetylpiperazin-1-yl)-3,5-difluoroanilino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[2-[4-(4-acetylpiperazin-1-yl)-3,5-difluoroanilino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118475632 |
| Molecular Formula | C26H26ClF2N7O2 |
| Molecular Weight | 541.99 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | N-[3-[[[2-[4-(4-acetylpiperazin-1-yl)-3,5-difluoroanilino]-5-chloropyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3cc(F)c(N4CCN(C(C)=O)CC4)c(F)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C26H26ClF2N7O2/c1-3-23(38)32-18-6-4-5-17(11-18)14-30-25-20(27)15-31-26(34-25)33-19-12-21(28)24(22(29)13-19)36-9-7-35(8-10-36)16(2)37/h3-6,11-13,15H,1,7-10,14H2,2H3,(H,32,38)(H2,30,31,33,34) |
| InChIKey | VGJFZRRNSWPSFD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.99 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|