C19H18ClF2N7O — CID 118475647
N-[3-[[[5-chloro-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 118475647) has the molecular formula C19H18ClF2N7O and a molecular weight of 433.85 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[5-chloro-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118475647 |
| Molecular Formula | C19H18ClF2N7O |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[3-[[[5-chloro-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3cnn(CC(F)F)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C19H18ClF2N7O/c1-2-17(30)26-13-5-3-4-12(6-13)7-23-18-15(20)9-24-19(28-18)27-14-8-25-29(10-14)11-16(21)22/h2-6,8-10,16H,1,7,11H2,(H,26,30)(H2,23,24,27,28) |
| InChIKey | DNWJLCUZQUTDQK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|