C26H27ClF2N6O3 — CID 118475651
N-[3-[[[5-chloro-2-[3,5-difluoro-4-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 118475651) has the molecular formula C26H27ClF2N6O3 and a molecular weight of 544.99 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-[3,5-difluoro-4-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[5-chloro-2-[3,5-difluoro-4-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118475651 |
| Molecular Formula | C26H27ClF2N6O3 |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-[3-[[[5-chloro-2-[3,5-difluoro-4-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3cc(F)c(OCCN4CCOCC4)c(F)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C26H27ClF2N6O3/c1-2-23(36)32-18-5-3-4-17(12-18)15-30-25-20(27)16-31-26(34-25)33-19-13-21(28)24(22(29)14-19)38-11-8-35-6-9-37-10-7-35/h2-5,12-14,16H,1,6-11,15H2,(H,32,36)(H2,30,31,33,34) |
| InChIKey | XXJGTGDAYFIFNL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|