C27H30N8O2 — CID 118475668
N-[3-[[2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-8-yl]methyl]phenyl]prop-2-enamide (PubChem CID 118475668) has the molecular formula C27H30N8O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-[3-[[2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-8-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-8-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118475668 |
| Molecular Formula | C27H30N8O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-[3-[[2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-8-yl]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CN2C(=O)NCc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C27H30N8O2/c1-3-24(36)30-22-6-4-5-19(15-22)18-35-25-20(17-29-27(35)37)16-28-26(32-25)31-21-7-9-23(10-8-21)34-13-11-33(2)12-14-34/h3-10,15-16H,1,11-14,17-18H2,2H3,(H,29,37)(H,30,36)(H,28,31,32) |
| InChIKey | AGBKFEBNVRZSLE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|