About N,6-dimethylhept-5-en-2-amine;ethanol
N,6-dimethylhept-5-en-2-amine;ethanol (PubChem CID 118475787) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is N,6-dimethylhept-5-en-2-amine;ethanol.
Molecular Properties
| Compound Name | N,6-dimethylhept-5-en-2-amine;ethanol |
| PubChem CID | 118475787 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | N,6-dimethylhept-5-en-2-amine;ethanol |
| SMILES | CCO.CNC(C)CCC=C(C)C |
| InChI | InChI=1S/C9H19N.C2H6O/c1-8(2)6-5-7-9(3)10-4;1-2-3/h6,9-10H,5,7H2,1-4H3;3H,2H2,1H3 |
| InChIKey | UYEJKUOLLDUBJY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,6-dimethylhept-5-en-2-amine;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethylhept-5-en-2-amine;ethanol?
The IUPAC name of N,6-dimethylhept-5-en-2-amine;ethanol (CID 118475787) is N,6-dimethylhept-5-en-2-amine;ethanol.
What is the SMILES notation for N,6-dimethylhept-5-en-2-amine;ethanol?
The canonical SMILES for N,6-dimethylhept-5-en-2-amine;ethanol is CCO.CNC(C)CCC=C(C)C.
What is the InChIKey of N,6-dimethylhept-5-en-2-amine;ethanol?
The InChIKey is UYEJKUOLLDUBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C2H6O/c1-8(2)6-5-7-9(3)10-4;1-2-3/h6,9-10H,5,7H2,1-4H3;3H,2H2,1H3.
What are the key properties of N,6-dimethylhept-5-en-2-amine;ethanol?
N,6-dimethylhept-5-en-2-amine;ethanol has a molecular weight of 187.33 g/mol, XLogP of 2.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethylhept-5-en-2-amine;ethanol is sourced from PubChem (CID 118475787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).