C25H25F6N5O2 — CID 118476132
3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 118476132) has the molecular formula C25H25F6N5O2 and a molecular weight of 541.50 g/mol. Its IUPAC name is 3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 118476132 |
| Molecular Formula | C25H25F6N5O2 |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | COc1ccc([C@H](C)NC(CC(=O)N2CCn3c(nnc3C(F)(F)F)C2)Cc2cc(F)c(F)cc2F)cc1 |
| InChI | InChI=1S/C25H25F6N5O2/c1-14(15-3-5-18(38-2)6-4-15)32-17(9-16-10-20(27)21(28)12-19(16)26)11-23(37)35-7-8-36-22(13-35)33-34-24(36)25(29,30)31/h3-6,10,12,14,17,32H,7-9,11,13H2,1-2H3/t14-,17?/m0/s1 |
| InChIKey | NVTQNVMZPMCDDM-MBIQTGHCSA-N |
| XLogP | 4.42 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|