C22H19F3N2O7S2 — CID 11847627
2-methyl-5-[(4-methylsulfonylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-sulfonic acid (PubChem CID 11847627) has the molecular formula C22H19F3N2O7S2 and a molecular weight of 544.53 g/mol. Its IUPAC name is 2-methyl-5-[(4-methylsulfonylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-sulfonic acid.
| Compound Name | 2-methyl-5-[(4-methylsulfonylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 11847627 |
| Molecular Formula | C22H19F3N2O7S2 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 2-methyl-5-[(4-methylsulfonylphenyl)methylcarbamoyl]-6-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-sulfonic acid |
| SMILES | Cc1c(S(=O)(=O)O)cc(C(=O)NCc2ccc(S(C)(=O)=O)cc2)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F3N2O7S2/c1-13-19(36(32,33)34)11-18(20(28)26-12-14-6-8-17(9-7-14)35(2,30)31)21(29)27(13)16-5-3-4-15(10-16)22(23,24)25/h3-11H,12H2,1-2H3,(H,26,28)(H,32,33,34) |
| InChIKey | GYRJKDOPJGUSPE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|