C30H35N5OS — CID 11847631
(6R)-N-[(1S)-2-amino-1-[3-(pyridin-3-ylmethylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 11847631) has the molecular formula C30H35N5OS and a molecular weight of 513.71 g/mol. Its IUPAC name is (6R)-N-[(1S)-2-amino-1-[3-(pyridin-3-ylmethylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6R)-N-[(1S)-2-amino-1-[3-(pyridin-3-ylmethylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 11847631 |
| Molecular Formula | C30H35N5OS |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | (6R)-N-[(1S)-2-amino-1-[3-(pyridin-3-ylmethylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2nc3sc(C(=O)N[C@H](CN)c4cccc(NCc5cccnc5)c4)cc3cc2C1 |
| InChI | InChI=1S/C30H35N5OS/c1-30(2,3)23-9-10-25-21(13-23)12-22-15-27(37-29(22)35-25)28(36)34-26(16-31)20-7-4-8-24(14-20)33-18-19-6-5-11-32-17-19/h4-8,11-12,14-15,17,23,26,33H,9-10,13,16,18,31H2,1-3H3,(H,34,36)/t23-,26-/m1/s1 |
| InChIKey | WGFABGCBFAVIOK-ZEQKJWHPSA-N |
| XLogP | 5.88 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |