C20H22N6O2 — CID 118476316
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-phenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 118476316) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-phenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-phenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 118476316 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-phenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)Nc1nc(Nc2ccccc2)nc(Nc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C20H22N6O2/c1-13(2)21-18-24-19(22-14-6-4-3-5-7-14)26-20(25-18)23-15-8-9-16-17(12-15)28-11-10-27-16/h3-9,12-13H,10-11H2,1-2H3,(H3,21,22,23,24,25,26) |
| InChIKey | WQGRGXQFFIMKFJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |