About ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate
ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate (PubChem CID 118476421) has the molecular formula C19H22BrN3O4
and a molecular weight of 436.31 g/mol. Its IUPAC name is ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate |
| PubChem CID | 118476421 |
| Molecular Formula | C19H22BrN3O4 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccnn1CC(C)(c1cccc(Br)c1)N1C(=O)OC1(C)C |
| InChI | InChI=1S/C19H22BrN3O4/c1-5-26-16(24)15-9-10-21-22(15)12-19(4,13-7-6-8-14(20)11-13)23-17(25)27-18(23,2)3/h6-11H,5,12H2,1-4H3 |
| InChIKey | BWBMUUCNKFCUQF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate?
The IUPAC name of ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate (CID 118476421) is ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate?
The canonical SMILES for ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate is CCOC(=O)c1ccnn1CC(C)(c1cccc(Br)c1)N1C(=O)OC1(C)C.
What is the InChIKey of ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate?
The InChIKey is BWBMUUCNKFCUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22BrN3O4/c1-5-26-16(24)15-9-10-21-22(15)12-19(4,13-7-6-8-14(20)11-13)23-17(25)27-18(23,2)3/h6-11H,5,12H2,1-4H3.
What are the key properties of ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate?
ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate has a molecular weight of 436.31 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(3-bromophenyl)-2-(2,2-dimethyl-4-oxo-1,3-oxazetidin-3-yl)propyl]pyrazole-3-carboxylate is sourced from PubChem (CID 118476421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).