C27H25FN2O2 — CID 118477291
1-[4-(6-fluoro-5-oxo-6-prop-2-enyl-7,8-dihydronaphthalen-2-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 118477291) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[4-(6-fluoro-5-oxo-6-prop-2-enyl-7,8-dihydronaphthalen-2-yl)phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-(6-fluoro-5-oxo-6-prop-2-enyl-7,8-dihydronaphthalen-2-yl)phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 118477291 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[4-(6-fluoro-5-oxo-6-prop-2-enyl-7,8-dihydronaphthalen-2-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | C=CCC1(F)CCc2cc(-c3ccc(NC(=O)Nc4cccc(C)c4)cc3)ccc2C1=O |
| InChI | InChI=1S/C27H25FN2O2/c1-3-14-27(28)15-13-21-17-20(9-12-24(21)25(27)31)19-7-10-22(11-8-19)29-26(32)30-23-6-4-5-18(2)16-23/h3-12,16-17H,1,13-15H2,2H3,(H2,29,30,32) |
| InChIKey | YMVQSHDBILDIKR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|