C25H18F6O4S2 — CID 118477641
2-ethyl-3-[2-(2-ethyl-1,1-dioxo-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene 1,1-dioxide (PubChem CID 118477641) has the molecular formula C25H18F6O4S2 and a molecular weight of 560.54 g/mol. Its IUPAC name is 2-ethyl-3-[2-(2-ethyl-1,1-dioxo-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene 1,1-dioxide.
| Compound Name | 2-ethyl-3-[2-(2-ethyl-1,1-dioxo-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 118477641 |
| Molecular Formula | C25H18F6O4S2 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 2-ethyl-3-[2-(2-ethyl-1,1-dioxo-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1-benzothiophene 1,1-dioxide |
| SMILES | CCC1=C(C2=C(C3=C(CC)S(=O)(=O)c4ccccc43)C(F)(F)C(F)(F)C2(F)F)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C25H18F6O4S2/c1-3-15-19(13-9-5-7-11-17(13)36(15,32)33)21-22(24(28,29)25(30,31)23(21,26)27)20-14-10-6-8-12-18(14)37(34,35)16(20)4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | DWQHPBJTKNXWJR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|