C16H26F2O5 — CID 118477797
methyl (2S,4S,5R)-6-[(2R,3R)-3-acetyloxypentan-2-yl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate (PubChem CID 118477797) has the molecular formula C16H26F2O5 and a molecular weight of 336.38 g/mol. Its IUPAC name is methyl (2S,4S,5R)-6-[(2R,3R)-3-acetyloxypentan-2-yl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R)-6-[(2R,3R)-3-acetyloxypentan-2-yl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 118477797 |
| Molecular Formula | C16H26F2O5 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl (2S,4S,5R)-6-[(2R,3R)-3-acetyloxypentan-2-yl]-2,3-difluoro-4,5-dimethyloxane-2-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](C)C1O[C@](F)(C(=O)OC)C(F)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C16H26F2O5/c1-7-12(22-11(5)19)10(4)13-8(2)9(3)14(17)16(18,23-13)15(20)21-6/h8-10,12-14H,7H2,1-6H3/t8-,9+,10-,12-,13?,14?,16+/m1/s1 |
| InChIKey | DMGPBZPGSUNKDX-OKYPQELRSA-N |
| XLogP | 2.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |