C19H28O — CID 118477846
4,6-ditert-butyl-1,2,3,3a,5,7a-hexahydrocyclopenta[a]pentalen-7-one (PubChem CID 118477846) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 4,6-ditert-butyl-1,2,3,3a,5,7a-hexahydrocyclopenta[a]pentalen-7-one.
| Compound Name | 4,6-ditert-butyl-1,2,3,3a,5,7a-hexahydrocyclopenta[a]pentalen-7-one |
|---|---|
| PubChem CID | 118477846 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 4,6-ditert-butyl-1,2,3,3a,5,7a-hexahydrocyclopenta[a]pentalen-7-one |
| SMILES | CC(C)(C)C1=C2C(=O)C3CCCC3C2=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C19H28O/c1-18(2,3)13-10-14(19(4,5)6)16-15(13)11-8-7-9-12(11)17(16)20/h11-12H,7-10H2,1-6H3 |
| InChIKey | RHQYNGBRXBBWEK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |