About (2R)-2,3-ditert-butyl-2H-furan-5-one
(2R)-2,3-ditert-butyl-2H-furan-5-one (PubChem CID 118478073) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (2R)-2,3-ditert-butyl-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-2,3-ditert-butyl-2H-furan-5-one |
| PubChem CID | 118478073 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2R)-2,3-ditert-butyl-2H-furan-5-one |
| SMILES | CC(C)(C)C1=CC(=O)O[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C12H20O2/c1-11(2,3)8-7-9(13)14-10(8)12(4,5)6/h7,10H,1-6H3/t10-/m0/s1 |
| InChIKey | APMUOIPSEIBDBH-JTQLQIEISA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2,3-ditert-butyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3-ditert-butyl-2H-furan-5-one?
The IUPAC name of (2R)-2,3-ditert-butyl-2H-furan-5-one (CID 118478073) is (2R)-2,3-ditert-butyl-2H-furan-5-one.
What is the SMILES notation for (2R)-2,3-ditert-butyl-2H-furan-5-one?
The canonical SMILES for (2R)-2,3-ditert-butyl-2H-furan-5-one is CC(C)(C)C1=CC(=O)O[C@@H]1C(C)(C)C.
What is the InChIKey of (2R)-2,3-ditert-butyl-2H-furan-5-one?
The InChIKey is APMUOIPSEIBDBH-JTQLQIEISA-N. The full InChI is InChI=1S/C12H20O2/c1-11(2,3)8-7-9(13)14-10(8)12(4,5)6/h7,10H,1-6H3/t10-/m0/s1.
What are the key properties of (2R)-2,3-ditert-butyl-2H-furan-5-one?
(2R)-2,3-ditert-butyl-2H-furan-5-one has a molecular weight of 196.29 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-ditert-butyl-2H-furan-5-one is sourced from PubChem (CID 118478073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).