C19H34O6 — CID 118478078
(3R,4R,5R)-5-ethenyl-7,7-dimethyl-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,6-dioxaspiro[2.5]octane (PubChem CID 118478078) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3R,4R,5R)-5-ethenyl-7,7-dimethyl-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,6-dioxaspiro[2.5]octane.
| Compound Name | (3R,4R,5R)-5-ethenyl-7,7-dimethyl-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 118478078 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (3R,4R,5R)-5-ethenyl-7,7-dimethyl-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]-1,6-dioxaspiro[2.5]octane |
| SMILES | C=C[C@H]1OC(C)(C)C[C@@]2(CO2)[C@@H]1OCCOCCOCCOCCC |
| InChI | InChI=1S/C19H34O6/c1-5-7-20-8-9-21-10-11-22-12-13-23-17-16(6-2)25-18(3,4)14-19(17)15-24-19/h6,16-17H,2,5,7-15H2,1,3-4H3/t16-,17-,19-/m1/s1 |
| InChIKey | JVILKPKULZMAJX-ZHALLVOQSA-N |
| XLogP | 2.35 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|