C27H34N4O3S — CID 11847820
ethyl N-[3-[(1S)-2-amino-1-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]phenyl]carbamate (PubChem CID 11847820) has the molecular formula C27H34N4O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is ethyl N-[3-[(1S)-2-amino-1-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[(1S)-2-amino-1-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 11847820 |
| Molecular Formula | C27H34N4O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | ethyl N-[3-[(1S)-2-amino-1-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc([C@@H](CN)NC(=O)c2cc3cc4c(nc3s2)CCC(C(C)(C)C)C4)c1 |
| InChI | InChI=1S/C27H34N4O3S/c1-5-34-26(33)29-20-8-6-7-16(13-20)22(15-28)30-24(32)23-14-18-11-17-12-19(27(2,3)4)9-10-21(17)31-25(18)35-23/h6-8,11,13-14,19,22H,5,9-10,12,15,28H2,1-4H3,(H,29,33)(H,30,32)/t19?,22-/m1/s1 |
| InChIKey | KUVXCHNJTOXYFW-AVKWCDSFSA-N |
| XLogP | 5.45 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |