C19H15N5O4S — CID 118478208
2-[[5-[3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 118478208) has the molecular formula C19H15N5O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is 2-[[5-[3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 118478208 |
| Molecular Formula | C19H15N5O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[[5-[3-(1-methylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Cn1ccc2cc(-c3cc(-c4nc(SCC(=O)O)n[nH]4)cc([N+](=O)[O-])c3)ccc21 |
| InChI | InChI=1S/C19H15N5O4S/c1-23-5-4-12-6-11(2-3-16(12)23)13-7-14(9-15(8-13)24(27)28)18-20-19(22-21-18)29-10-17(25)26/h2-9H,10H2,1H3,(H,25,26)(H,20,21,22) |
| InChIKey | LDKAZRWUYFGPFJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|