C17H15ClN4OS — CID 118478247
N-(3-chlorophenyl)-3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 118478247) has the molecular formula C17H15ClN4OS and a molecular weight of 358.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-(3-chlorophenyl)-3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 118478247 |
| Molecular Formula | C17H15ClN4OS |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(3-chlorophenyl)-3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | CCSc1n[nH]c(-c2cccc(C(=O)Nc3cccc(Cl)c3)c2)n1 |
| InChI | InChI=1S/C17H15ClN4OS/c1-2-24-17-20-15(21-22-17)11-5-3-6-12(9-11)16(23)19-14-8-4-7-13(18)10-14/h3-10H,2H2,1H3,(H,19,23)(H,20,21,22) |
| InChIKey | ZRMFUFOOZVJTIE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |