C18H14N6O4S — CID 118478270
2-[[5-[3-(2-amino-1H-indol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 118478270) has the molecular formula C18H14N6O4S and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[[5-[3-(2-amino-1H-indol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(2-amino-1H-indol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 118478270 |
| Molecular Formula | C18H14N6O4S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-[[5-[3-(2-amino-1H-indol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Nc1cc2cc(-c3cc(-c4nc(SCC(=O)O)n[nH]4)cc([N+](=O)[O-])c3)ccc2[nH]1 |
| InChI | InChI=1S/C18H14N6O4S/c19-15-7-11-3-9(1-2-14(11)20-15)10-4-12(6-13(5-10)24(27)28)17-21-18(23-22-17)29-8-16(25)26/h1-7,20H,8,19H2,(H,25,26)(H,21,22,23) |
| InChIKey | HBPNUIDDPCKTLG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 163.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|