C21H30N6O2S — CID 118478590
3-[6-amino-5-[2-imino-1-(2-methylhydrazinyl)ethyl]-3-pyridinyl]-N-cyclohexyl-4-methylbenzenesulfonamide (PubChem CID 118478590) has the molecular formula C21H30N6O2S and a molecular weight of 430.58 g/mol. Its IUPAC name is 3-[6-amino-5-[2-imino-1-(2-methylhydrazinyl)ethyl]-3-pyridinyl]-N-cyclohexyl-4-methylbenzenesulfonamide.
| Compound Name | 3-[6-amino-5-[2-imino-1-(2-methylhydrazinyl)ethyl]-3-pyridinyl]-N-cyclohexyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 118478590 |
| Molecular Formula | C21H30N6O2S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 3-[6-amino-5-[2-imino-1-(2-methylhydrazinyl)ethyl]-3-pyridinyl]-N-cyclohexyl-4-methylbenzenesulfonamide |
| SMILES | [H]/N=C/C(NNC)c1cc(-c2cc(S(=O)(=O)NC3CCCCC3)ccc2C)cnc1N |
| InChI | InChI=1S/C21H30N6O2S/c1-14-8-9-17(30(28,29)27-16-6-4-3-5-7-16)11-18(14)15-10-19(21(23)25-13-15)20(12-22)26-24-2/h8-13,16,20,22,24,26-27H,3-7H2,1-2H3,(H2,23,25)/b22-12+ |
| InChIKey | HIESGNJLCLWWAU-WSDLNYQXSA-N |
| XLogP | 2.66 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|