About 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine
2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine (PubChem CID 118478764) has the molecular formula C8H9ClF3N
and a molecular weight of 211.61 g/mol. Its IUPAC name is 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine |
| PubChem CID | 118478764 |
| Molecular Formula | C8H9ClF3N |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine |
| SMILES | CN1C=C(C(F)(F)F)C=CC1(C)Cl |
| InChI | InChI=1S/C8H9ClF3N/c1-7(9)4-3-6(5-13(7)2)8(10,11)12/h3-5H,1-2H3 |
| InChIKey | QJOOTCCSJJVCCA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine?
The IUPAC name of 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine (CID 118478764) is 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine?
The canonical SMILES for 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine is CN1C=C(C(F)(F)F)C=CC1(C)Cl.
What is the InChIKey of 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine?
The InChIKey is QJOOTCCSJJVCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3N/c1-7(9)4-3-6(5-13(7)2)8(10,11)12/h3-5H,1-2H3.
What are the key properties of 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine?
2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine has a molecular weight of 211.61 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,2-dimethyl-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 118478764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).