About (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol
(2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 118478786) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol |
| PubChem CID | 118478786 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | CC1C=C([C@H](N)CO)C=CC1 |
| InChI | InChI=1S/C9H15NO/c1-7-3-2-4-8(5-7)9(10)6-11/h2,4-5,7,9,11H,3,6,10H2,1H3/t7?,9-/m1/s1 |
| InChIKey | ANMHENBSILIKBN-NHSZFOGYSA-N |
| XLogP | 0.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
The IUPAC name of (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol (CID 118478786) is (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol.
What is the SMILES notation for (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
The canonical SMILES for (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol is CC1C=C([C@H](N)CO)C=CC1.
What is the InChIKey of (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
The InChIKey is ANMHENBSILIKBN-NHSZFOGYSA-N. The full InChI is InChI=1S/C9H15NO/c1-7-3-2-4-8(5-7)9(10)6-11/h2,4-5,7,9,11H,3,6,10H2,1H3/t7?,9-/m1/s1.
What are the key properties of (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol?
(2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol has a molecular weight of 153.22 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-(3-methylcyclohexa-1,5-dien-1-yl)ethanol is sourced from PubChem (CID 118478786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).