C11H17N3 — CID 118478823
(4S,6R)-5,12-dimethyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene (PubChem CID 118478823) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (4S,6R)-5,12-dimethyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene.
| Compound Name | (4S,6R)-5,12-dimethyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
|---|---|
| PubChem CID | 118478823 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (4S,6R)-5,12-dimethyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
| SMILES | CC1[C@H]2CCc3nnn(C)c3CC[C@@H]12 |
| InChI | InChI=1S/C11H17N3/c1-7-8-3-5-10-11(6-4-9(7)8)14(2)13-12-10/h7-9H,3-6H2,1-2H3/t7?,8-,9+/m1/s1 |
| InChIKey | ORLDODHBZMZGAH-ASODMVGOSA-N |
| XLogP | 1.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |