C21H21ClF2O5S — CID 118478848
[(6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-(hydroxymethyl)-6a,8,9,10-tetrahydro-6H-benzo[c]chromen-7-yl]methanol (PubChem CID 118478848) has the molecular formula C21H21ClF2O5S and a molecular weight of 458.91 g/mol. Its IUPAC name is [(6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-(hydroxymethyl)-6a,8,9,10-tetrahydro-6H-benzo[c]chromen-7-yl]methanol.
| Compound Name | [(6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-(hydroxymethyl)-6a,8,9,10-tetrahydro-6H-benzo[c]chromen-7-yl]methanol |
|---|---|
| PubChem CID | 118478848 |
| Molecular Formula | C21H21ClF2O5S |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [(6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-(hydroxymethyl)-6a,8,9,10-tetrahydro-6H-benzo[c]chromen-7-yl]methanol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@@]12CCCC(CO)(CO)[C@@H]1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C21H21ClF2O5S/c22-13-2-4-14(5-3-13)30(27,28)21-9-1-8-20(11-25,12-26)17(21)10-29-19-16(24)7-6-15(23)18(19)21/h2-7,17,25-26H,1,8-12H2/t17-,21-/m0/s1 |
| InChIKey | DCLAUMXJFMZEKA-UWJYYQICSA-N |
| XLogP | 3.45 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |