C28H31N5O2S2 — CID 11847918
(6R)-N-[(1S)-2-amino-1-[3-(1,2-thiazole-5-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 11847918) has the molecular formula C28H31N5O2S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is (6R)-N-[(1S)-2-amino-1-[3-(1,2-thiazole-5-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6R)-N-[(1S)-2-amino-1-[3-(1,2-thiazole-5-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 11847918 |
| Molecular Formula | C28H31N5O2S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (6R)-N-[(1S)-2-amino-1-[3-(1,2-thiazole-5-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2nc3sc(C(=O)N[C@H](CN)c4cccc(NC(=O)c5ccns5)c4)cc3cc2C1 |
| InChI | InChI=1S/C28H31N5O2S2/c1-28(2,3)19-7-8-21-17(12-19)11-18-14-24(36-27(18)33-21)26(35)32-22(15-29)16-5-4-6-20(13-16)31-25(34)23-9-10-30-37-23/h4-6,9-11,13-14,19,22H,7-8,12,15,29H2,1-3H3,(H,31,34)(H,32,35)/t19-,22-/m1/s1 |
| InChIKey | SMFBIMNVMZQONC-DENIHFKCSA-N |
| XLogP | 5.59 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |