C16H18O3 — CID 118479513
(3aS,6aR,9bS)-6a-methyl-3,6,9-trimethylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2,8-dione (PubChem CID 118479513) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (3aS,6aR,9bS)-6a-methyl-3,6,9-trimethylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2,8-dione.
| Compound Name | (3aS,6aR,9bS)-6a-methyl-3,6,9-trimethylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2,8-dione |
|---|---|
| PubChem CID | 118479513 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (3aS,6aR,9bS)-6a-methyl-3,6,9-trimethylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2,8-dione |
| SMILES | C=C1C(=O)C[C@@]2(C)C(=C)CC[C@H]3C(=C)C(=O)O[C@@H]3C12 |
| InChI | InChI=1S/C16H18O3/c1-8-5-6-11-9(2)15(18)19-14(11)13-10(3)12(17)7-16(8,13)4/h11,13-14H,1-3,5-7H2,4H3/t11-,13?,14-,16-/m0/s1 |
| InChIKey | PMLKDJRKOGIQGT-WJQULIJNSA-N |
| XLogP | 2.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|