C20H25F3N8O2 — CID 118479641
N'-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide (PubChem CID 118479641) has the molecular formula C20H25F3N8O2 and a molecular weight of 466.47 g/mol. Its IUPAC name is N'-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 118479641 |
| Molecular Formula | C20H25F3N8O2 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N'-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C20H25F3N8O2/c1-29(2)13-25-16-11-15(20(21,22)23)14(12-24-16)17-26-18(30-3-7-32-8-4-30)28-19(27-17)31-5-9-33-10-6-31/h11-13H,3-10H2,1-2H3/b25-13+ |
| InChIKey | PPMVDQSQHSEYHY-DHRITJCHSA-N |
| XLogP | 1.85 |
| TPSA | 92.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|