C14H19NO — CID 118479685
(3E,4Z,6Z)-6-(N-ethenyl-C-methylcarbonimidoyl)-3-ethylideneocta-4,6-dien-2-one (PubChem CID 118479685) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3E,4Z,6Z)-6-(N-ethenyl-C-methylcarbonimidoyl)-3-ethylideneocta-4,6-dien-2-one.
| Compound Name | (3E,4Z,6Z)-6-(N-ethenyl-C-methylcarbonimidoyl)-3-ethylideneocta-4,6-dien-2-one |
|---|---|
| PubChem CID | 118479685 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3E,4Z,6Z)-6-(N-ethenyl-C-methylcarbonimidoyl)-3-ethylideneocta-4,6-dien-2-one |
| SMILES | C=C/N=C(C)/C(/C=C\C(=C/C)C(C)=O)=C\C |
| InChI | InChI=1S/C14H19NO/c1-6-13(11(4)15-8-3)9-10-14(7-2)12(5)16/h6-10H,3H2,1-2,4-5H3/b10-9-,13-6-,14-7+,15-11+ |
| InChIKey | PIYURVJHYMOUFR-WVXMJZCSSA-N |
| XLogP | 3.63 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|