C21H19F4N5O — CID 118479718
(3-cyclopropyl-4,5-difluorophenyl)-[(5S)-3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]methanone (PubChem CID 118479718) has the molecular formula C21H19F4N5O and a molecular weight of 433.41 g/mol. Its IUPAC name is (3-cyclopropyl-4,5-difluorophenyl)-[(5S)-3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]methanone.
| Compound Name | (3-cyclopropyl-4,5-difluorophenyl)-[(5S)-3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118479718 |
| Molecular Formula | C21H19F4N5O |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (3-cyclopropyl-4,5-difluorophenyl)-[(5S)-3,3-difluoro-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cc([C@@H]2CN(C(=O)c3cc(F)c(F)c(C4CC4)c3)CC(F)(F)C2)n2ncnc2n1 |
| InChI | InChI=1S/C21H19F4N5O/c1-11-4-17(30-20(28-11)26-10-27-30)14-7-21(24,25)9-29(8-14)19(31)13-5-15(12-2-3-12)18(23)16(22)6-13/h4-6,10,12,14H,2-3,7-9H2,1H3/t14-/m0/s1 |
| InChIKey | KJDZNINUSCFSQQ-AWEZNQCLSA-N |
| XLogP | 3.85 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |