C20H15N5O3S — CID 118479816
amino 2-[[5-[5-(9H-carbazol-3-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 118479816) has the molecular formula C20H15N5O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is amino 2-[[5-[5-(9H-carbazol-3-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | amino 2-[[5-[5-(9H-carbazol-3-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 118479816 |
| Molecular Formula | C20H15N5O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | amino 2-[[5-[5-(9H-carbazol-3-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | NOC(=O)CSc1n[nH]c(-c2ccc(-c3ccc4[nH]c5ccccc5c4c3)o2)n1 |
| InChI | InChI=1S/C20H15N5O3S/c21-28-18(26)10-29-20-23-19(24-25-20)17-8-7-16(27-17)11-5-6-15-13(9-11)12-3-1-2-4-14(12)22-15/h1-9,22H,10,21H2,(H,23,24,25) |
| InChIKey | GBSIJUUCFZSAIT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 122.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|