C29H33N5O2S — CID 11848040
(6R)-N-[(1S)-2-amino-1-[3-(1H-pyrrole-2-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 11848040) has the molecular formula C29H33N5O2S and a molecular weight of 515.68 g/mol. Its IUPAC name is (6R)-N-[(1S)-2-amino-1-[3-(1H-pyrrole-2-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6R)-N-[(1S)-2-amino-1-[3-(1H-pyrrole-2-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 11848040 |
| Molecular Formula | C29H33N5O2S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (6R)-N-[(1S)-2-amino-1-[3-(1H-pyrrole-2-carbonylamino)phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2nc3sc(C(=O)N[C@H](CN)c4cccc(NC(=O)c5ccc[nH]5)c4)cc3cc2C1 |
| InChI | InChI=1S/C29H33N5O2S/c1-29(2,3)20-9-10-22-18(13-20)12-19-15-25(37-28(19)34-22)27(36)33-24(16-30)17-6-4-7-21(14-17)32-26(35)23-8-5-11-31-23/h4-8,11-12,14-15,20,24,31H,9-10,13,16,30H2,1-3H3,(H,32,35)(H,33,36)/t20-,24-/m1/s1 |
| InChIKey | XXRRBGFHJHXTFN-HYBUGGRVSA-N |
| XLogP | 5.46 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |